C25H35N3O3 — CID 142931797
N-[4-[2-[acetyl(methyl)amino]ethyl-ethylamino]phenyl]-2-[4-(2-methylpropoxy)phenyl]acetamide (PubChem CID 142931797) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-[4-[2-[acetyl(methyl)amino]ethyl-ethylamino]phenyl]-2-[4-(2-methylpropoxy)phenyl]acetamide.
| Compound Name | N-[4-[2-[acetyl(methyl)amino]ethyl-ethylamino]phenyl]-2-[4-(2-methylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 142931797 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[4-[2-[acetyl(methyl)amino]ethyl-ethylamino]phenyl]-2-[4-(2-methylpropoxy)phenyl]acetamide |
| SMILES | CCN(CCN(C)C(C)=O)c1ccc(NC(=O)Cc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H35N3O3/c1-6-28(16-15-27(5)20(4)29)23-11-9-22(10-12-23)26-25(30)17-21-7-13-24(14-8-21)31-18-19(2)3/h7-14,19H,6,15-18H2,1-5H3,(H,26,30) |
| InChIKey | IWIBTTGSXFTMQO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|