C18H20O4 — CID 142933069
[(2E)-2-ethenylpenta-2,4-dienyl] 6-methyl-3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate (PubChem CID 142933069) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 6-methyl-3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 6-methyl-3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate |
|---|---|
| PubChem CID | 142933069 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 6-methyl-3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)c1ccc2c(c1C)OCCCO2 |
| InChI | InChI=1S/C18H20O4/c1-4-7-14(5-2)12-22-18(19)15-8-9-16-17(13(15)3)21-11-6-10-20-16/h4-5,7-9H,1-2,6,10-12H2,3H3/b14-7+ |
| InChIKey | XWMRUKZATHFXTL-VGOFMYFVSA-N |
| XLogP | 3.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|