C25H34N4O3S — CID 142933175
2-[(1-aminoisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-methylsulfanylacetamide;ethane (PubChem CID 142933175) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is 2-[(1-aminoisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-methylsulfanylacetamide;ethane.
| Compound Name | 2-[(1-aminoisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-methylsulfanylacetamide;ethane |
|---|---|
| PubChem CID | 142933175 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-[(1-aminoisoquinolin-6-yl)amino]-2-(3-ethoxy-4-propan-2-yloxyphenyl)-N-methylsulfanylacetamide;ethane |
| SMILES | CC.CCOc1cc(C(Nc2ccc3c(N)nccc3c2)C(=O)NSC)ccc1OC(C)C |
| InChI | InChI=1S/C23H28N4O3S.C2H6/c1-5-29-20-13-16(6-9-19(20)30-14(2)3)21(23(28)27-31-4)26-17-7-8-18-15(12-17)10-11-25-22(18)24;1-2/h6-14,21,26H,5H2,1-4H3,(H2,24,25)(H,27,28);1-2H3 |
| InChIKey | LHFGFVKPSCBMHY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|