About (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol
(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol (PubChem CID 142933357) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol.
Molecular Properties
| Compound Name | (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol |
| PubChem CID | 142933357 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol |
| SMILES | C/C(O)=C(O)\C=C1\CCNC(C)C1 |
| InChI | InChI=1S/C10H17NO2/c1-7-5-9(3-4-11-7)6-10(13)8(2)12/h6-7,11-13H,3-5H2,1-2H3/b9-6-,10-8- |
| InChIKey | DWHKOYHALMXDQT-PTKGMRGESA-N |
| XLogP | 2.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol?
The IUPAC name of (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol (CID 142933357) is (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol.
What is the SMILES notation for (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol?
The canonical SMILES for (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol is C/C(O)=C(O)\C=C1\CCNC(C)C1.
What is the InChIKey of (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol?
The InChIKey is DWHKOYHALMXDQT-PTKGMRGESA-N. The full InChI is InChI=1S/C10H17NO2/c1-7-5-9(3-4-11-7)6-10(13)8(2)12/h6-7,11-13H,3-5H2,1-2H3/b9-6-,10-8-.
What are the key properties of (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol?
(Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol has a molecular weight of 183.25 g/mol, XLogP of 2.03, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,1Z)-1-(2-methylpiperidin-4-ylidene)but-2-ene-2,3-diol is sourced from PubChem (CID 142933357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).