C34H41N3O — CID 142933372
2-[[(2E,3Z)-3-(2-cyclobutylethylidene)-2-ethylidene-7-methyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide (PubChem CID 142933372) has the molecular formula C34H41N3O and a molecular weight of 507.72 g/mol. Its IUPAC name is 2-[[(2E,3Z)-3-(2-cyclobutylethylidene)-2-ethylidene-7-methyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide.
| Compound Name | 2-[[(2E,3Z)-3-(2-cyclobutylethylidene)-2-ethylidene-7-methyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide |
|---|---|
| PubChem CID | 142933372 |
| Molecular Formula | C34H41N3O |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | 2-[[(2E,3Z)-3-(2-cyclobutylethylidene)-2-ethylidene-7-methyl-1,4,5,7-tetrahydropyrrolo[2,3-c]pyridin-6-yl]methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide |
| SMILES | C/C=c1/[nH]c2c(/c1=C/CC1CCC1)CCN(Cc1ccccc1C(=O)NCC/C=C/c1ccccc1)C2C |
| InChI | InChI=1S/C34H41N3O/c1-3-32-30(20-19-27-15-11-16-27)31-21-23-37(25(2)33(31)36-32)24-28-17-7-8-18-29(28)34(38)35-22-10-9-14-26-12-5-4-6-13-26/h3-9,12-14,17-18,20,25,27,36H,10-11,15-16,19,21-24H2,1-2H3,(H,35,38)/b14-9+,30-20-,32-3+ |
| InChIKey | RLLRZJDPPZZKCN-LNNGIHCISA-N |
| XLogP | 5.74 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|