About (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine
(3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine (PubChem CID 142933399) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine.
Molecular Properties
| Compound Name | (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine |
| PubChem CID | 142933399 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine |
| SMILES | C/C=C/C1CCNC1.C=C(/C=C\CC)OC |
| InChI | InChI=1S/C7H13N.C7H12O/c1-2-3-7-4-5-8-6-7;1-4-5-6-7(2)8-3/h2-3,7-8H,4-6H2,1H3;5-6H,2,4H2,1,3H3/b3-2+;6-5- |
| InChIKey | ORAZJYIUEPXIKO-AUJFFYEYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine?
The IUPAC name of (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine (CID 142933399) is (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine.
What is the SMILES notation for (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine?
The canonical SMILES for (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine is C/C=C/C1CCNC1.C=C(/C=C\CC)OC.
What is the InChIKey of (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine?
The InChIKey is ORAZJYIUEPXIKO-AUJFFYEYSA-N. The full InChI is InChI=1S/C7H13N.C7H12O/c1-2-3-7-4-5-8-6-7;1-4-5-6-7(2)8-3/h2-3,7-8H,4-6H2,1H3;5-6H,2,4H2,1,3H3/b3-2+;6-5-.
What are the key properties of (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine?
(3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine has a molecular weight of 223.36 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-methoxyhexa-1,3-diene;3-[(E)-prop-1-enyl]pyrrolidine is sourced from PubChem (CID 142933399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).