C15H20N2O4 — CID 142933412
2,2-dimethyl-5-[[(5-methyl-2-pyridinyl)amino]methylidene]-1,3-dioxane-4,6-dione;ethane (PubChem CID 142933412) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(5-methyl-2-pyridinyl)amino]methylidene]-1,3-dioxane-4,6-dione;ethane.
| Compound Name | 2,2-dimethyl-5-[[(5-methyl-2-pyridinyl)amino]methylidene]-1,3-dioxane-4,6-dione;ethane |
|---|---|
| PubChem CID | 142933412 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2,2-dimethyl-5-[[(5-methyl-2-pyridinyl)amino]methylidene]-1,3-dioxane-4,6-dione;ethane |
| SMILES | CC.Cc1ccc(NC=C2C(=O)OC(C)(C)OC2=O)nc1 |
| InChI | InChI=1S/C13H14N2O4.C2H6/c1-8-4-5-10(14-6-8)15-7-9-11(16)18-13(2,3)19-12(9)17;1-2/h4-7H,1-3H3,(H,14,15);1-2H3 |
| InChIKey | CUVNHCQBGWDQQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|