About ethane;4H-pyrido[1,2-a]pyrimidine
ethane;4H-pyrido[1,2-a]pyrimidine (PubChem CID 142933435) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is ethane;4H-pyrido[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | ethane;4H-pyrido[1,2-a]pyrimidine |
| PubChem CID | 142933435 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;4H-pyrido[1,2-a]pyrimidine |
| SMILES | C1=CC2=NC=CCN2C=C1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-6-10-7-3-5-9-8(10)4-1;1-2/h1-6H,7H2;1-2H3 |
| InChIKey | AKNVIJIZWZMJCZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4H-pyrido[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4H-pyrido[1,2-a]pyrimidine?
The IUPAC name of ethane;4H-pyrido[1,2-a]pyrimidine (CID 142933435) is ethane;4H-pyrido[1,2-a]pyrimidine.
What is the SMILES notation for ethane;4H-pyrido[1,2-a]pyrimidine?
The canonical SMILES for ethane;4H-pyrido[1,2-a]pyrimidine is C1=CC2=NC=CCN2C=C1.CC.
What is the InChIKey of ethane;4H-pyrido[1,2-a]pyrimidine?
The InChIKey is AKNVIJIZWZMJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6/c1-2-6-10-7-3-5-9-8(10)4-1;1-2/h1-6H,7H2;1-2H3.
What are the key properties of ethane;4H-pyrido[1,2-a]pyrimidine?
ethane;4H-pyrido[1,2-a]pyrimidine has a molecular weight of 162.24 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4H-pyrido[1,2-a]pyrimidine is sourced from PubChem (CID 142933435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).