About 6,7-dihydroquinoxaline;ethane
6,7-dihydroquinoxaline;ethane (PubChem CID 142933454) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 6,7-dihydroquinoxaline;ethane.
Molecular Properties
| Compound Name | 6,7-dihydroquinoxaline;ethane |
| PubChem CID | 142933454 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 6,7-dihydroquinoxaline;ethane |
| SMILES | C1=c2nccnc2=CCC1.CC |
| InChI | InChI=1S/C8H8N2.C2H6/c1-2-4-8-7(3-1)9-5-6-10-8;1-2/h3-6H,1-2H2;1-2H3 |
| InChIKey | LKEUCGVFCBYTLN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydroquinoxaline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroquinoxaline;ethane?
The IUPAC name of 6,7-dihydroquinoxaline;ethane (CID 142933454) is 6,7-dihydroquinoxaline;ethane.
What is the SMILES notation for 6,7-dihydroquinoxaline;ethane?
The canonical SMILES for 6,7-dihydroquinoxaline;ethane is C1=c2nccnc2=CCC1.CC.
What is the InChIKey of 6,7-dihydroquinoxaline;ethane?
The InChIKey is LKEUCGVFCBYTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6/c1-2-4-8-7(3-1)9-5-6-10-8;1-2/h3-6H,1-2H2;1-2H3.
What are the key properties of 6,7-dihydroquinoxaline;ethane?
6,7-dihydroquinoxaline;ethane has a molecular weight of 162.24 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroquinoxaline;ethane is sourced from PubChem (CID 142933454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).