C17H26S — CID 142934073
acetylene;(2E,4Z)-6-methyl-3-[(2Z,4Z)-4-methylhexa-2,4-dienyl]sulfanylhepta-2,4-diene (PubChem CID 142934073) has the molecular formula C17H26S and a molecular weight of 262.46 g/mol. Its IUPAC name is acetylene;(2E,4Z)-6-methyl-3-[(2Z,4Z)-4-methylhexa-2,4-dienyl]sulfanylhepta-2,4-diene.
| Compound Name | acetylene;(2E,4Z)-6-methyl-3-[(2Z,4Z)-4-methylhexa-2,4-dienyl]sulfanylhepta-2,4-diene |
|---|---|
| PubChem CID | 142934073 |
| Molecular Formula | C17H26S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | acetylene;(2E,4Z)-6-methyl-3-[(2Z,4Z)-4-methylhexa-2,4-dienyl]sulfanylhepta-2,4-diene |
| SMILES | C#C.C/C=C(C)\C=C/CSC(/C=C\C(C)C)=C/C |
| InChI | InChI=1S/C15H24S.C2H2/c1-6-14(5)9-8-12-16-15(7-2)11-10-13(3)4;1-2/h6-11,13H,12H2,1-5H3;1-2H/b9-8-,11-10-,14-6-,15-7+; |
| InChIKey | SODQFLKWJGQXKP-KQFSHUFOSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|