C14H28N2O3 — CID 142934117
N-ethyl-2-methylidenebutanamide;N-methyl-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 142934117) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is N-ethyl-2-methylidenebutanamide;N-methyl-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-ethyl-2-methylidenebutanamide;N-methyl-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 142934117 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-ethyl-2-methylidenebutanamide;N-methyl-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | C=C(CC)C(=O)NCC.CNC(=O)COC(C)(C)C |
| InChI | InChI=1S/C7H15NO2.C7H13NO/c1-7(2,3)10-5-6(9)8-4;1-4-6(3)7(9)8-5-2/h5H2,1-4H3,(H,8,9);3-5H2,1-2H3,(H,8,9) |
| InChIKey | SEBUVUUIPKPYAV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|