About 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate
1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate (PubChem CID 142934119) has the molecular formula C16H28N2O6
and a molecular weight of 344.41 g/mol. Its IUPAC name is 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate |
| PubChem CID | 142934119 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CNC(=O)OC(C)(C)C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N2O6/c1-8-12(19)22-11(9-17-13(20)23-15(2,3)4)10-18-14(21)24-16(5,6)7/h8,11H,1,9-10H2,2-7H3,(H,17,20)(H,18,21) |
| InChIKey | NKDUZESQWKFKAH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate?
The IUPAC name of 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate (CID 142934119) is 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate.
What is the SMILES notation for 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate?
The canonical SMILES for 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate is C=CC(=O)OC(CNC(=O)OC(C)(C)C)CNC(=O)OC(C)(C)C.
What is the InChIKey of 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate?
The InChIKey is NKDUZESQWKFKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O6/c1-8-12(19)22-11(9-17-13(20)23-15(2,3)4)10-18-14(21)24-16(5,6)7/h8,11H,1,9-10H2,2-7H3,(H,17,20)(H,18,21).
What are the key properties of 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate?
1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate has a molecular weight of 344.41 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl prop-2-enoate is sourced from PubChem (CID 142934119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).