C23H29ClF3NO4 — CID 142934232
N-benzyl-N-[(4-chlorophenyl)methyl]-2-(2-propoxyethoxy)ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 142934232) has the molecular formula C23H29ClF3NO4 and a molecular weight of 475.94 g/mol. Its IUPAC name is N-benzyl-N-[(4-chlorophenyl)methyl]-2-(2-propoxyethoxy)ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-benzyl-N-[(4-chlorophenyl)methyl]-2-(2-propoxyethoxy)ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 142934232 |
| Molecular Formula | C23H29ClF3NO4 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-benzyl-N-[(4-chlorophenyl)methyl]-2-(2-propoxyethoxy)ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | CCCOCCOCCN(Cc1ccccc1)Cc1ccc(Cl)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28ClNO2.C2HF3O2/c1-2-13-24-15-16-25-14-12-23(17-19-6-4-3-5-7-19)18-20-8-10-21(22)11-9-20;3-2(4,5)1(6)7/h3-11H,2,12-18H2,1H3;(H,6,7) |
| InChIKey | OXJVXLKKKYYQIQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|