C21H31FN6O — CID 142934727
ethane;6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide (PubChem CID 142934727) has the molecular formula C21H31FN6O and a molecular weight of 402.52 g/mol. Its IUPAC name is ethane;6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide.
| Compound Name | ethane;6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142934727 |
| Molecular Formula | C21H31FN6O |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | ethane;6-fluoro-N-[(Z)-2-(methylideneamino)-3-(1H-1,2,4-triazol-5-yl)hex-2-enyl]-N-(2-methylpropyl)pyridine-2-carboxamide |
| SMILES | C=N/C(CN(CC(C)C)C(=O)c1cccc(F)n1)=C(/CCC)c1ncn[nH]1.CC |
| InChI | InChI=1S/C19H25FN6O.C2H6/c1-5-7-14(18-22-12-23-25-18)16(21-4)11-26(10-13(2)3)19(27)15-8-6-9-17(20)24-15;1-2/h6,8-9,12-13H,4-5,7,10-11H2,1-3H3,(H,22,23,25);1-2H3/b16-14-; |
| InChIKey | BUWFFMLGZBLHEO-ULQCMBKMSA-N |
| XLogP | 4.38 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|