C20H25FN5O3PS3 — CID 142934937
[4-amino-2-[[1-[(E,1Z)-1-(sulfanylmethylimino)but-2-en-2-yl]sulfonylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone (PubChem CID 142934937) has the molecular formula C20H25FN5O3PS3 and a molecular weight of 529.63 g/mol. Its IUPAC name is [4-amino-2-[[1-[(E,1Z)-1-(sulfanylmethylimino)but-2-en-2-yl]sulfonylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone.
| Compound Name | [4-amino-2-[[1-[(E,1Z)-1-(sulfanylmethylimino)but-2-en-2-yl]sulfonylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone |
|---|---|
| PubChem CID | 142934937 |
| Molecular Formula | C20H25FN5O3PS3 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [4-amino-2-[[1-[(E,1Z)-1-(sulfanylmethylimino)but-2-en-2-yl]sulfonylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone |
| SMILES | C/C=C(\C=N/CS)S(=O)(=O)N1CCC(Nc2nc(N)c(C(=O)c3c(F)cccc3P)s2)CC1 |
| InChI | InChI=1S/C20H25FN5O3PS3/c1-2-13(10-23-11-31)33(28,29)26-8-6-12(7-9-26)24-20-25-19(22)18(32-20)17(27)16-14(21)4-3-5-15(16)30/h2-5,10,12,31H,6-9,11,22,30H2,1H3,(H,24,25)/b13-2+,23-10- |
| InChIKey | ARAAIIBLLZGTFF-BVUGVGGOSA-N |
| XLogP | 2.66 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|