C26H29FN5OPS2 — CID 142935017
[4-amino-2-[[1-[4-[3-(dimethylamino)prop-1-ynyl]phenyl]sulfanylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone (PubChem CID 142935017) has the molecular formula C26H29FN5OPS2 and a molecular weight of 541.66 g/mol. Its IUPAC name is [4-amino-2-[[1-[4-[3-(dimethylamino)prop-1-ynyl]phenyl]sulfanylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone.
| Compound Name | [4-amino-2-[[1-[4-[3-(dimethylamino)prop-1-ynyl]phenyl]sulfanylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone |
|---|---|
| PubChem CID | 142935017 |
| Molecular Formula | C26H29FN5OPS2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [4-amino-2-[[1-[4-[3-(dimethylamino)prop-1-ynyl]phenyl]sulfanylpiperidin-4-yl]amino]-1,3-thiazol-5-yl]-(2-fluoro-6-phosphanylphenyl)methanone |
| SMILES | CN(C)CC#Cc1ccc(SN2CCC(Nc3nc(N)c(C(=O)c4c(F)cccc4P)s3)CC2)cc1 |
| InChI | InChI=1S/C26H29FN5OPS2/c1-31(2)14-4-5-17-8-10-19(11-9-17)36-32-15-12-18(13-16-32)29-26-30-25(28)24(35-26)23(33)22-20(27)6-3-7-21(22)34/h3,6-11,18H,12-16,28,34H2,1-2H3,(H,29,30) |
| InChIKey | YXBOUTRVESFVCZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|