C21H24O3 — CID 142935318
6-cyclopentyl-6-[2-(3-prop-2-ynylphenyl)ethyl]oxane-2,4-dione (PubChem CID 142935318) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3-prop-2-ynylphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3-prop-2-ynylphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 142935318 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3-prop-2-ynylphenyl)ethyl]oxane-2,4-dione |
| SMILES | C#CCc1cccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)c1 |
| InChI | InChI=1S/C21H24O3/c1-2-6-16-7-5-8-17(13-16)11-12-21(18-9-3-4-10-18)15-19(22)14-20(23)24-21/h1,5,7-8,13,18H,3-4,6,9-12,14-15H2 |
| InChIKey | UADJKYGKIZOANQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|