About ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate
ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate (PubChem CID 142935396) has the molecular formula C19H21F3O2S
and a molecular weight of 370.44 g/mol. Its IUPAC name is ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate |
| PubChem CID | 142935396 |
| Molecular Formula | C19H21F3O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate |
| SMILES | CCOC(=O)CCC1CC=C(Sc2cccc(C(F)(F)F)c2)C=C1C |
| InChI | InChI=1S/C19H21F3O2S/c1-3-24-18(23)10-8-14-7-9-17(11-13(14)2)25-16-6-4-5-15(12-16)19(20,21)22/h4-6,9,11-12,14H,3,7-8,10H2,1-2H3 |
| InChIKey | OLWZOGNKJJWULV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate?
The IUPAC name of ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate (CID 142935396) is ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate.
What is the SMILES notation for ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate?
The canonical SMILES for ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate is CCOC(=O)CCC1CC=C(Sc2cccc(C(F)(F)F)c2)C=C1C.
What is the InChIKey of ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate?
The InChIKey is OLWZOGNKJJWULV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3O2S/c1-3-24-18(23)10-8-14-7-9-17(11-13(14)2)25-16-6-4-5-15(12-16)19(20,21)22/h4-6,9,11-12,14H,3,7-8,10H2,1-2H3.
What are the key properties of ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate?
ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate has a molecular weight of 370.44 g/mol, XLogP of 5.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]sulfanylcyclohexa-2,4-dien-1-yl]propanoate is sourced from PubChem (CID 142935396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).