C39H58N2O — CID 142935482
(3Z,6E)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylidene-6-[(3Z)-8-[(4R)-3-methyl-4-[5-(1,3-oxazolidin-3-yl)cyclohepten-1-yl]pentyl]cyclooct-3-en-1-ylidene]octa-1,3-dien-2-amine (PubChem CID 142935482) has the molecular formula C39H58N2O and a molecular weight of 570.91 g/mol. Its IUPAC name is (3Z,6E)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylidene-6-[(3Z)-8-[(4R)-3-methyl-4-[5-(1,3-oxazolidin-3-yl)cyclohepten-1-yl]pentyl]cyclooct-3-en-1-ylidene]octa-1,3-dien-2-amine.
| Compound Name | (3Z,6E)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylidene-6-[(3Z)-8-[(4R)-3-methyl-4-[5-(1,3-oxazolidin-3-yl)cyclohepten-1-yl]pentyl]cyclooct-3-en-1-ylidene]octa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 142935482 |
| Molecular Formula | C39H58N2O |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 570.45 |
| IUPAC Name | (3Z,6E)-N-[(3Z)-hexa-1,3,5-trien-2-yl]-5-methylidene-6-[(3Z)-8-[(4R)-3-methyl-4-[5-(1,3-oxazolidin-3-yl)cyclohepten-1-yl]pentyl]cyclooct-3-en-1-ylidene]octa-1,3-dien-2-amine |
| SMILES | C=C/C=C\C(=C)NC(=C)/C=C\C(=C)/C(CC)=C1\C/C=C\CCCC1CCC(C)[C@@H](C)C1=CCCC(N2CCOC2)CC1 |
| InChI | InChI=1S/C39H58N2O/c1-8-10-16-32(5)40-33(6)23-21-31(4)38(9-2)39-20-14-12-11-13-17-36(39)24-22-30(3)34(7)35-18-15-19-37(26-25-35)41-27-28-42-29-41/h8,10,12,14,16,18,21,23,30,34,36-37,40H,1,4-6,9,11,13,15,17,19-20,22,24-29H2,2-3,7H3/b14-12-,16-10-,23-21-,39-38+/t30?,34-,36?,37?/m1/s1 |
| InChIKey | UMCGOWKUHVSAHA-BPDQZOTJSA-N |
| XLogP | 10.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|