C13H23NO — CID 142935844
4-(2,3,6,7-tetrahydrooxepin-4-ylmethyl)cyclohexan-1-amine (PubChem CID 142935844) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 4-(2,3,6,7-tetrahydrooxepin-4-ylmethyl)cyclohexan-1-amine.
| Compound Name | 4-(2,3,6,7-tetrahydrooxepin-4-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 142935844 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 4-(2,3,6,7-tetrahydrooxepin-4-ylmethyl)cyclohexan-1-amine |
| SMILES | NC1CCC(CC2=CCCOCC2)CC1 |
| InChI | InChI=1S/C13H23NO/c14-13-5-3-12(4-6-13)10-11-2-1-8-15-9-7-11/h2,12-13H,1,3-10,14H2 |
| InChIKey | ZQHLHIGHACMYIK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|