C15H21NO — CID 142936057
ethane;4-ethyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole (PubChem CID 142936057) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;4-ethyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole.
| Compound Name | ethane;4-ethyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 142936057 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | ethane;4-ethyl-5-methyl-2-(3-methylphenyl)-1,3-oxazole |
| SMILES | CC.CCc1nc(-c2cccc(C)c2)oc1C |
| InChI | InChI=1S/C13H15NO.C2H6/c1-4-12-10(3)15-13(14-12)11-7-5-6-9(2)8-11;1-2/h5-8H,4H2,1-3H3;1-2H3 |
| InChIKey | BEKSODBMVDDQSK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |