C10H13NO2 — CID 142936091
(2E,4E,5Z)-4-ethylidene-2-hydroxyiminoocta-5,7-dien-3-one (PubChem CID 142936091) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2E,4E,5Z)-4-ethylidene-2-hydroxyiminoocta-5,7-dien-3-one.
| Compound Name | (2E,4E,5Z)-4-ethylidene-2-hydroxyiminoocta-5,7-dien-3-one |
|---|---|
| PubChem CID | 142936091 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2E,4E,5Z)-4-ethylidene-2-hydroxyiminoocta-5,7-dien-3-one |
| SMILES | C=C/C=C\C(=C/C)C(=O)/C(C)=N/O |
| InChI | InChI=1S/C10H13NO2/c1-4-6-7-9(5-2)10(12)8(3)11-13/h4-7,13H,1H2,2-3H3/b7-6-,9-5+,11-8+ |
| InChIKey | NHEAVCCAMQWMFQ-JTTHPCARSA-N |
| XLogP | 2.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|