About tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene
tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene (PubChem CID 142936162) has the molecular formula C30H44O4S
and a molecular weight of 500.75 g/mol. Its IUPAC name is tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene.
Molecular Properties
| Compound Name | tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene |
| PubChem CID | 142936162 |
| Molecular Formula | C30H44O4S |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene |
| SMILES | C=CC.CC(C)(C)OC(=O)C(C)(C)OCC1CCCC(O)C1.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C15H28O4.C12H10S.C3H6/c1-14(2,3)19-13(17)15(4,5)18-10-11-7-6-8-12(16)9-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h11-12,16H,6-10H2,1-5H3;1-10H;3H,1H2,2H3 |
| InChIKey | KQOAWTVBUOJZRY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene?
The IUPAC name of tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene (CID 142936162) is tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene.
What is the SMILES notation for tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene?
The canonical SMILES for tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene is C=CC.CC(C)(C)OC(=O)C(C)(C)OCC1CCCC(O)C1.c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene?
The InChIKey is KQOAWTVBUOJZRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4.C12H10S.C3H6/c1-14(2,3)19-13(17)15(4,5)18-10-11-7-6-8-12(16)9-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h11-12,16H,6-10H2,1-5H3;1-10H;3H,1H2,2H3.
What are the key properties of tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene?
tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene has a molecular weight of 500.75 g/mol, XLogP of 7.70, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3-hydroxycyclohexyl)methoxy]-2-methylpropanoate;phenylsulfanylbenzene;prop-1-ene is sourced from PubChem (CID 142936162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).