C25H34OS — CID 142936187
1,1'-biphenyl;1-tert-butylsulfanyloxy-3-prop-2-enylcyclohexane (PubChem CID 142936187) has the molecular formula C25H34OS and a molecular weight of 382.61 g/mol. Its IUPAC name is 1,1'-biphenyl;1-tert-butylsulfanyloxy-3-prop-2-enylcyclohexane.
| Compound Name | 1,1'-biphenyl;1-tert-butylsulfanyloxy-3-prop-2-enylcyclohexane |
|---|---|
| PubChem CID | 142936187 |
| Molecular Formula | C25H34OS |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1,1'-biphenyl;1-tert-butylsulfanyloxy-3-prop-2-enylcyclohexane |
| SMILES | C=CCC1CCCC(OSC(C)(C)C)C1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H24OS.C12H10/c1-5-7-11-8-6-9-12(10-11)14-15-13(2,3)4;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5,11-12H,1,6-10H2,2-4H3;1-10H |
| InChIKey | DPKTYTTWZCQEGJ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|