C28H35NO2 — CID 142936388
3-[[3-[2-(2-naphthalen-2-yl-3H-pyrrol-5-yl)ethyl]cyclohexyl]oxymethyl]pent-1-en-2-ol (PubChem CID 142936388) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is 3-[[3-[2-(2-naphthalen-2-yl-3H-pyrrol-5-yl)ethyl]cyclohexyl]oxymethyl]pent-1-en-2-ol.
| Compound Name | 3-[[3-[2-(2-naphthalen-2-yl-3H-pyrrol-5-yl)ethyl]cyclohexyl]oxymethyl]pent-1-en-2-ol |
|---|---|
| PubChem CID | 142936388 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 3-[[3-[2-(2-naphthalen-2-yl-3H-pyrrol-5-yl)ethyl]cyclohexyl]oxymethyl]pent-1-en-2-ol |
| SMILES | C=C(O)C(CC)COC1CCCC(CCC2=CCC(c3ccc4ccccc4c3)=N2)C1 |
| InChI | InChI=1S/C28H35NO2/c1-3-22(20(2)30)19-31-27-10-6-7-21(17-27)11-14-26-15-16-28(29-26)25-13-12-23-8-4-5-9-24(23)18-25/h4-5,8-9,12-13,15,18,21-22,27,30H,2-3,6-7,10-11,14,16-17,19H2,1H3 |
| InChIKey | RIFZDNSMQOWVTQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|