About 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine]
5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] (PubChem CID 142936580) has the molecular formula C15H19FN2
and a molecular weight of 246.33 g/mol. Its IUPAC name is 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine].
Molecular Properties
| Compound Name | 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] |
| PubChem CID | 142936580 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] |
| SMILES | C=C1N(C)c2ccc(F)cc2C12CCN(C)CC2 |
| InChI | InChI=1S/C15H19FN2/c1-11-15(6-8-17(2)9-7-15)13-10-12(16)4-5-14(13)18(11)3/h4-5,10H,1,6-9H2,2-3H3 |
| InChIKey | LFRCALPZFJWTIN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine]?
The IUPAC name of 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] (CID 142936580) is 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine].
What is the SMILES notation for 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine]?
The canonical SMILES for 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] is C=C1N(C)c2ccc(F)cc2C12CCN(C)CC2.
What is the InChIKey of 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine]?
The InChIKey is LFRCALPZFJWTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2/c1-11-15(6-8-17(2)9-7-15)13-10-12(16)4-5-14(13)18(11)3/h4-5,10H,1,6-9H2,2-3H3.
What are the key properties of 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine]?
5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] has a molecular weight of 246.33 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,1'-dimethyl-2-methylidenespiro[indole-3,4'-piperidine] is sourced from PubChem (CID 142936580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).