About 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane
2-amino-1-piperidin-1-ylethanethione;methylcyclohexane (PubChem CID 142937110) has the molecular formula C14H28N2S
and a molecular weight of 256.46 g/mol. Its IUPAC name is 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane.
Molecular Properties
| Compound Name | 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane |
| PubChem CID | 142937110 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane |
| SMILES | CC1CCCCC1.NCC(=S)N1CCCCC1 |
| InChI | InChI=1S/C7H14N2S.C7H14/c8-6-7(10)9-4-2-1-3-5-9;1-7-5-3-2-4-6-7/h1-6,8H2;7H,2-6H2,1H3 |
| InChIKey | FTLCREIBXLAMFV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane?
The IUPAC name of 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane (CID 142937110) is 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane.
What is the SMILES notation for 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane?
The canonical SMILES for 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane is CC1CCCCC1.NCC(=S)N1CCCCC1.
What is the InChIKey of 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane?
The InChIKey is FTLCREIBXLAMFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S.C7H14/c8-6-7(10)9-4-2-1-3-5-9;1-7-5-3-2-4-6-7/h1-6,8H2;7H,2-6H2,1H3.
What are the key properties of 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane?
2-amino-1-piperidin-1-ylethanethione;methylcyclohexane has a molecular weight of 256.46 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-piperidin-1-ylethanethione;methylcyclohexane is sourced from PubChem (CID 142937110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).