C22H19IN4OS — CID 142937250
2-iodo-N-[4-methyl-3-[(4-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]benzamide (PubChem CID 142937250) has the molecular formula C22H19IN4OS and a molecular weight of 514.39 g/mol. Its IUPAC name is 2-iodo-N-[4-methyl-3-[(4-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]benzamide.
| Compound Name | 2-iodo-N-[4-methyl-3-[(4-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 142937250 |
| Molecular Formula | C22H19IN4OS |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | 2-iodo-N-[4-methyl-3-[(4-pyridin-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2I)cc1NC1=NC(c2cccnc2)CS1 |
| InChI | InChI=1S/C22H19IN4OS/c1-14-8-9-16(25-21(28)17-6-2-3-7-18(17)23)11-19(14)26-22-27-20(13-29-22)15-5-4-10-24-12-15/h2-12,20H,13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | RILZEFSBLRXUPY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|