C31H37F3N2O4S — CID 142937262
ethane;(E)-2-[(3E)-2-methylidene-3-[[7-(trifluoromethyl)quinolin-4-yl]sulfanylmethyl]hexa-3,5-dienoxy]-3-[(Z)-1-morpholin-4-ylbut-2-en-2-yl]oxyprop-2-enal (PubChem CID 142937262) has the molecular formula C31H37F3N2O4S and a molecular weight of 590.71 g/mol. Its IUPAC name is ethane;(E)-2-[(3E)-2-methylidene-3-[[7-(trifluoromethyl)quinolin-4-yl]sulfanylmethyl]hexa-3,5-dienoxy]-3-[(Z)-1-morpholin-4-ylbut-2-en-2-yl]oxyprop-2-enal.
| Compound Name | ethane;(E)-2-[(3E)-2-methylidene-3-[[7-(trifluoromethyl)quinolin-4-yl]sulfanylmethyl]hexa-3,5-dienoxy]-3-[(Z)-1-morpholin-4-ylbut-2-en-2-yl]oxyprop-2-enal |
|---|---|
| PubChem CID | 142937262 |
| Molecular Formula | C31H37F3N2O4S |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | ethane;(E)-2-[(3E)-2-methylidene-3-[[7-(trifluoromethyl)quinolin-4-yl]sulfanylmethyl]hexa-3,5-dienoxy]-3-[(Z)-1-morpholin-4-ylbut-2-en-2-yl]oxyprop-2-enal |
| SMILES | C=C/C=C(/CSc1ccnc2cc(C(F)(F)F)ccc12)C(=C)CO/C(C=O)=C/O/C(=C\C)CN1CCOCC1.CC |
| InChI | InChI=1S/C29H31F3N2O4S.C2H6/c1-4-6-22(20-39-28-9-10-33-27-15-23(29(30,31)32)7-8-26(27)28)21(3)18-37-25(17-35)19-38-24(5-2)16-34-11-13-36-14-12-34;1-2/h4-10,15,17,19H,1,3,11-14,16,18,20H2,2H3;1-2H3/b22-6-,24-5-,25-19+; |
| InChIKey | LEXCNKQLMHYPLK-CJCDDDKFSA-N |
| XLogP | 7.35 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|