About 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one
7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one (PubChem CID 14293860) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one.
Molecular Properties
| Compound Name | 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one |
| PubChem CID | 14293860 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one |
| SMILES | Cc1cc(C)c2c(c1)oc(=O)c1[nH]ncc12 |
| InChI | InChI=1S/C12H10N2O2/c1-6-3-7(2)10-8-5-13-14-11(8)12(15)16-9(10)4-6/h3-5H,1-2H3,(H,13,14) |
| InChIKey | VFWHWVGBSZYYDC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one?
The IUPAC name of 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one (CID 14293860) is 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one.
What is the SMILES notation for 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one?
The canonical SMILES for 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one is Cc1cc(C)c2c(c1)oc(=O)c1[nH]ncc12.
What is the InChIKey of 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one?
The InChIKey is VFWHWVGBSZYYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c1-6-3-7(2)10-8-5-13-14-11(8)12(15)16-9(10)4-6/h3-5H,1-2H3,(H,13,14).
What are the key properties of 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one?
7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one has a molecular weight of 214.22 g/mol, XLogP of 2.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dimethyl-3H-chromeno[4,3-d]pyrazol-4-one is sourced from PubChem (CID 14293860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).