C19H24 — CID 142938750
(7Z)-5,8-dimethyl-7-penta-2,4-dienyl-5,6,9,10-tetrahydrobenzo[8]annulene (PubChem CID 142938750) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is (7Z)-5,8-dimethyl-7-penta-2,4-dienyl-5,6,9,10-tetrahydrobenzo[8]annulene.
| Compound Name | (7Z)-5,8-dimethyl-7-penta-2,4-dienyl-5,6,9,10-tetrahydrobenzo[8]annulene |
|---|---|
| PubChem CID | 142938750 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (7Z)-5,8-dimethyl-7-penta-2,4-dienyl-5,6,9,10-tetrahydrobenzo[8]annulene |
| SMILES | C=CC=CC/C1=C(\C)CCc2ccccc2C(C)C1 |
| InChI | InChI=1S/C19H24/c1-4-5-6-10-18-14-16(3)19-11-8-7-9-17(19)13-12-15(18)2/h4-9,11,16H,1,10,12-14H2,2-3H3/b6-5?,18-15- |
| InChIKey | XHMZFYSMLYYCST-DCSSPLAZSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|