C14H23NO2 — CID 142939348
1-[(2Z,4E,6Z)-6-methoxyocta-2,4,6-trien-4-yl]piperidin-4-ol (PubChem CID 142939348) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-[(2Z,4E,6Z)-6-methoxyocta-2,4,6-trien-4-yl]piperidin-4-ol.
| Compound Name | 1-[(2Z,4E,6Z)-6-methoxyocta-2,4,6-trien-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 142939348 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-[(2Z,4E,6Z)-6-methoxyocta-2,4,6-trien-4-yl]piperidin-4-ol |
| SMILES | C/C=C\C(=C/C(=C/C)OC)N1CCC(O)CC1 |
| InChI | InChI=1S/C14H23NO2/c1-4-6-12(11-14(5-2)17-3)15-9-7-13(16)8-10-15/h4-6,11,13,16H,7-10H2,1-3H3/b6-4-,12-11+,14-5- |
| InChIKey | MDBWOALTKCTWEK-COGPDKRVSA-N |
| XLogP | 2.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|