About 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane
1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane (PubChem CID 142939372) has the molecular formula C22H43N3
and a molecular weight of 349.61 g/mol. Its IUPAC name is 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane.
Molecular Properties
| Compound Name | 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane |
| PubChem CID | 142939372 |
| Molecular Formula | C22H43N3 |
| Molecular Weight | 349.61 g/mol |
| Exact Mass | 349.35 |
| IUPAC Name | 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane |
| SMILES | C/C=C\CN1CCC(N2CCN(C)CC2)CC1.CC#CCC.CCC |
| InChI | InChI=1S/C14H27N3.C5H8.C3H8/c1-3-4-7-16-8-5-14(6-9-16)17-12-10-15(2)11-13-17;1-3-5-4-2;1-3-2/h3-4,14H,5-13H2,1-2H3;3H2,1-2H3;3H2,1-2H3/b4-3-;; |
| InChIKey | VUSZYRKSYXSDNR-GSBNXNDCSA-N |
| XLogP | 4.11 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane?
The IUPAC name of 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane (CID 142939372) is 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane.
What is the SMILES notation for 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane?
The canonical SMILES for 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane is C/C=C\CN1CCC(N2CCN(C)CC2)CC1.CC#CCC.CCC.
What is the InChIKey of 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane?
The InChIKey is VUSZYRKSYXSDNR-GSBNXNDCSA-N. The full InChI is InChI=1S/C14H27N3.C5H8.C3H8/c1-3-4-7-16-8-5-14(6-9-16)17-12-10-15(2)11-13-17;1-3-5-4-2;1-3-2/h3-4,14H,5-13H2,1-2H3;3H2,1-2H3;3H2,1-2H3/b4-3-;;.
What are the key properties of 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane?
1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane has a molecular weight of 349.61 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(Z)-but-2-enyl]piperidin-4-yl]-4-methylpiperazine;pent-2-yne;propane is sourced from PubChem (CID 142939372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).