About 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane
1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane (PubChem CID 142939412) has the molecular formula C16H29N3O2
and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane.
Molecular Properties
| Compound Name | 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane |
| PubChem CID | 142939412 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane |
| SMILES | C.COC1=C(N)CC=CC(N2CCC(N(C)OC)CC2)=C1 |
| InChI | InChI=1S/C15H25N3O2.CH4/c1-17(20-3)12-7-9-18(10-8-12)13-5-4-6-14(16)15(11-13)19-2;/h4-5,11-12H,6-10,16H2,1-3H3;1H4 |
| InChIKey | LVASLILOIUKASK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane?
The IUPAC name of 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane (CID 142939412) is 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane.
What is the SMILES notation for 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane?
The canonical SMILES for 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane is C.COC1=C(N)CC=CC(N2CCC(N(C)OC)CC2)=C1.
What is the InChIKey of 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane?
The InChIKey is LVASLILOIUKASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2.CH4/c1-17(20-3)12-7-9-18(10-8-12)13-5-4-6-14(16)15(11-13)19-2;/h4-5,11-12H,6-10,16H2,1-3H3;1H4.
What are the key properties of 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane?
1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane has a molecular weight of 295.43 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3-methoxycyclohepta-1,3,6-trien-1-yl)-N-methoxy-N-methylpiperidin-4-amine;methane is sourced from PubChem (CID 142939412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).