C32H50O3 — CID 142939494
ethane;1-[4-(3-ethyl-1,3,7-trimethyl-2,7-dihydroazulen-1-yl)-1-methylcyclohepta-2,4,6-trien-1-yl]-2-hydroxy-2-methylpropan-1-one;propan-2-ol (PubChem CID 142939494) has the molecular formula C32H50O3 and a molecular weight of 482.75 g/mol. Its IUPAC name is ethane;1-[4-(3-ethyl-1,3,7-trimethyl-2,7-dihydroazulen-1-yl)-1-methylcyclohepta-2,4,6-trien-1-yl]-2-hydroxy-2-methylpropan-1-one;propan-2-ol.
| Compound Name | ethane;1-[4-(3-ethyl-1,3,7-trimethyl-2,7-dihydroazulen-1-yl)-1-methylcyclohepta-2,4,6-trien-1-yl]-2-hydroxy-2-methylpropan-1-one;propan-2-ol |
|---|---|
| PubChem CID | 142939494 |
| Molecular Formula | C32H50O3 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | ethane;1-[4-(3-ethyl-1,3,7-trimethyl-2,7-dihydroazulen-1-yl)-1-methylcyclohepta-2,4,6-trien-1-yl]-2-hydroxy-2-methylpropan-1-one;propan-2-ol |
| SMILES | CC.CC(C)O.CCC1(C)CC(C)(C2=CC=CC(C)(C(=O)C(C)(C)O)C=C2)C2=CC(C)C=CC=C21 |
| InChI | InChI=1S/C27H36O2.C3H8O.C2H6/c1-8-25(5)18-27(7,22-17-19(2)11-9-13-21(22)25)20-12-10-15-26(6,16-14-20)23(28)24(3,4)29;1-3(2)4;1-2/h9-17,19,29H,8,18H2,1-7H3;3-4H,1-2H3;1-2H3 |
| InChIKey | RDOQIYZMGDNYLB-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |