C10H13Cl3O3 — CID 14293956
methyl (Z)-5-methyl-2-(2,2,2-trichloroacetyl)hex-2-enoate (PubChem CID 14293956) has the molecular formula C10H13Cl3O3 and a molecular weight of 287.57 g/mol. Its IUPAC name is methyl (Z)-5-methyl-2-(2,2,2-trichloroacetyl)hex-2-enoate.
| Compound Name | methyl (Z)-5-methyl-2-(2,2,2-trichloroacetyl)hex-2-enoate |
|---|---|
| PubChem CID | 14293956 |
| Molecular Formula | C10H13Cl3O3 |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | methyl (Z)-5-methyl-2-(2,2,2-trichloroacetyl)hex-2-enoate |
| SMILES | COC(=O)/C(=C\CC(C)C)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13Cl3O3/c1-6(2)4-5-7(9(15)16-3)8(14)10(11,12)13/h5-6H,4H2,1-3H3/b7-5- |
| InChIKey | QCRDNGMIPDZJFO-ALCCZGGFSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|