C16H27N — CID 142939597
1-butyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine (PubChem CID 142939597) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 1-butyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine.
| Compound Name | 1-butyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 142939597 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-butyl-4-[(2Z)-2-ethenylpenta-2,4-dienyl]piperidine |
| SMILES | C=C/C=C(\C=C)CC1CCN(CCCC)CC1 |
| InChI | InChI=1S/C16H27N/c1-4-7-11-17-12-9-16(10-13-17)14-15(6-3)8-5-2/h5-6,8,16H,2-4,7,9-14H2,1H3/b15-8+ |
| InChIKey | KTJAOFYSDFTHQJ-OVCLIPMQSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|