About ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile
ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile (PubChem CID 142939705) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile.
Molecular Properties
| Compound Name | ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile |
| PubChem CID | 142939705 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile |
| SMILES | CC.N#CC1=CC=CC(C=O)C=C1 |
| InChI | InChI=1S/C9H7NO.C2H6/c10-6-8-2-1-3-9(7-11)5-4-8;1-2/h1-5,7,9H;1-2H3 |
| InChIKey | GGHHLQFMDBIXCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile?
The IUPAC name of ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile (CID 142939705) is ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile.
What is the SMILES notation for ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile?
The canonical SMILES for ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile is CC.N#CC1=CC=CC(C=O)C=C1.
What is the InChIKey of ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile?
The InChIKey is GGHHLQFMDBIXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C2H6/c10-6-8-2-1-3-9(7-11)5-4-8;1-2/h1-5,7,9H;1-2H3.
What are the key properties of ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile?
ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile has a molecular weight of 175.23 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-formylcyclohepta-1,3,6-triene-1-carbonitrile is sourced from PubChem (CID 142939705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).