C30H38N2O7 — CID 142939764
dimethyl 2-(4-methylphenyl)-3-[(3E,5E)-6-nitrohepta-3,5-dien-3-yl]-6-phenyloxazinane-4,4-dicarboxylate;ethane (PubChem CID 142939764) has the molecular formula C30H38N2O7 and a molecular weight of 538.64 g/mol. Its IUPAC name is dimethyl 2-(4-methylphenyl)-3-[(3E,5E)-6-nitrohepta-3,5-dien-3-yl]-6-phenyloxazinane-4,4-dicarboxylate;ethane.
| Compound Name | dimethyl 2-(4-methylphenyl)-3-[(3E,5E)-6-nitrohepta-3,5-dien-3-yl]-6-phenyloxazinane-4,4-dicarboxylate;ethane |
|---|---|
| PubChem CID | 142939764 |
| Molecular Formula | C30H38N2O7 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | dimethyl 2-(4-methylphenyl)-3-[(3E,5E)-6-nitrohepta-3,5-dien-3-yl]-6-phenyloxazinane-4,4-dicarboxylate;ethane |
| SMILES | CC.CC/C(=C\C=C(/C)[N+](=O)[O-])C1N(c2ccc(C)cc2)OC(c2ccccc2)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C28H32N2O7.C2H6/c1-6-21(15-14-20(3)30(33)34)25-28(26(31)35-4,27(32)36-5)18-24(22-10-8-7-9-11-22)37-29(25)23-16-12-19(2)13-17-23;1-2/h7-17,24-25H,6,18H2,1-5H3;1-2H3/b20-14+,21-15+; |
| InChIKey | HZKIJDPKJAHOGI-JICTWDTMSA-N |
| XLogP | 6.12 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|