C22H24N6O2S3 — CID 142939854
3-(6-ethyl-4-methylcyclohepta-1,3,6-trien-1-yl)sulfanyl-N-(1,3-thiazol-2-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide;methanol (PubChem CID 142939854) has the molecular formula C22H24N6O2S3 and a molecular weight of 500.68 g/mol. Its IUPAC name is 3-(6-ethyl-4-methylcyclohepta-1,3,6-trien-1-yl)sulfanyl-N-(1,3-thiazol-2-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide;methanol.
| Compound Name | 3-(6-ethyl-4-methylcyclohepta-1,3,6-trien-1-yl)sulfanyl-N-(1,3-thiazol-2-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide;methanol |
|---|---|
| PubChem CID | 142939854 |
| Molecular Formula | C22H24N6O2S3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 3-(6-ethyl-4-methylcyclohepta-1,3,6-trien-1-yl)sulfanyl-N-(1,3-thiazol-2-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridine-2-carboxamide;methanol |
| SMILES | CCC1=CC(Sc2ccc(Sc3ncn[nH]3)nc2C(=O)Nc2nccs2)=CC=C(C)C1.CO |
| InChI | InChI=1S/C21H20N6OS3.CH4O/c1-3-14-10-13(2)4-5-15(11-14)30-16-6-7-17(31-21-23-12-24-27-21)25-18(16)19(28)26-20-22-8-9-29-20;1-2/h4-9,11-12H,3,10H2,1-2H3,(H,22,26,28)(H,23,24,27);2H,1H3 |
| InChIKey | SUVIVCGSLMMWEG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |