C21H22N6O3S3 — CID 142939873
[6-[[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]carbamoyl]-5-(4-methoxyphenyl)sulfanyl-2-pyridinyl] N'-methyl-N-(methylideneamino)carbamimidothioate (PubChem CID 142939873) has the molecular formula C21H22N6O3S3 and a molecular weight of 502.65 g/mol. Its IUPAC name is [6-[[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]carbamoyl]-5-(4-methoxyphenyl)sulfanyl-2-pyridinyl] N'-methyl-N-(methylideneamino)carbamimidothioate.
| Compound Name | [6-[[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]carbamoyl]-5-(4-methoxyphenyl)sulfanyl-2-pyridinyl] N'-methyl-N-(methylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 142939873 |
| Molecular Formula | C21H22N6O3S3 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | [6-[[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]carbamoyl]-5-(4-methoxyphenyl)sulfanyl-2-pyridinyl] N'-methyl-N-(methylideneamino)carbamimidothioate |
| SMILES | C=NN/C(=N\C)Sc1ccc(Sc2ccc(OC)cc2)c(C(=O)Nc2nc(CCO)cs2)n1 |
| InChI | InChI=1S/C21H22N6O3S3/c1-22-20(27-23-2)33-17-9-8-16(32-15-6-4-14(30-3)5-7-15)18(25-17)19(29)26-21-24-13(10-11-28)12-31-21/h4-9,12,28H,2,10-11H2,1,3H3,(H,22,27)(H,24,26,29) |
| InChIKey | WYBYSPLUBJAUIQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|