About 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane
3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane (PubChem CID 142939929) has the molecular formula C19H36O
and a molecular weight of 280.50 g/mol. Its IUPAC name is 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane |
| PubChem CID | 142939929 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane |
| SMILES | C/C=C\c1oc(C=C(C)C)c(C)c1C.CC.CC.CC |
| InChI | InChI=1S/C13H18O.3C2H6/c1-6-7-12-10(4)11(5)13(14-12)8-9(2)3;3*1-2/h6-8H,1-5H3;3*1-2H3/b7-6-;;; |
| InChIKey | DWHCBLKKXWFPIQ-YYFHNNNUSA-N |
| XLogP | 7.43 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane?
The IUPAC name of 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane (CID 142939929) is 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane.
What is the SMILES notation for 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane?
The canonical SMILES for 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane is C/C=C\c1oc(C=C(C)C)c(C)c1C.CC.CC.CC.
What is the InChIKey of 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane?
The InChIKey is DWHCBLKKXWFPIQ-YYFHNNNUSA-N. The full InChI is InChI=1S/C13H18O.3C2H6/c1-6-7-12-10(4)11(5)13(14-12)8-9(2)3;3*1-2/h6-8H,1-5H3;3*1-2H3/b7-6-;;;.
What are the key properties of 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane?
3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane has a molecular weight of 280.50 g/mol, XLogP of 7.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-(2-methylprop-1-enyl)-5-[(Z)-prop-1-enyl]furan;ethane is sourced from PubChem (CID 142939929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).