C27H31F2N3O3 — CID 142940169
acetylene;2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide;(2S,3Z)-1-methyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one (PubChem CID 142940169) has the molecular formula C27H31F2N3O3 and a molecular weight of 483.56 g/mol. Its IUPAC name is acetylene;2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide;(2S,3Z)-1-methyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one.
| Compound Name | acetylene;2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide;(2S,3Z)-1-methyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one |
|---|---|
| PubChem CID | 142940169 |
| Molecular Formula | C27H31F2N3O3 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | acetylene;2-[[2-(3,5-difluorophenyl)acetyl]amino]propanamide;(2S,3Z)-1-methyl-2-phenyl-2,5,6,7-tetrahydroazocin-8-one |
| SMILES | C#C.CC(NC(=O)Cc1cc(F)cc(F)c1)C(N)=O.CN1C(=O)CCC/C=C\[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO.C11H12F2N2O2.C2H2/c1-15-13(12-8-4-2-5-9-12)10-6-3-7-11-14(15)16;1-6(11(14)17)15-10(16)4-7-2-8(12)5-9(13)3-7;1-2/h2,4-6,8-10,13H,3,7,11H2,1H3;2-3,5-6H,4H2,1H3,(H2,14,17)(H,15,16);1-2H/b10-6-;;/t13-;;/m0../s1 |
| InChIKey | UXNAOVQMLDZQRF-UNSSWHSPSA-N |
| XLogP | 3.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|