About 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole
6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole (PubChem CID 142940477) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole.
Molecular Properties
| Compound Name | 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole |
| PubChem CID | 142940477 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole |
| SMILES | C=Cc1ccc2c(c1)Cc1cn[nH]c1-2 |
| InChI | InChI=1S/C12H10N2/c1-2-8-3-4-11-9(5-8)6-10-7-13-14-12(10)11/h2-5,7H,1,6H2,(H,13,14) |
| InChIKey | FXEPWHXEXVMLAU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole?
The IUPAC name of 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole (CID 142940477) is 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole.
What is the SMILES notation for 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole?
The canonical SMILES for 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole is C=Cc1ccc2c(c1)Cc1cn[nH]c1-2.
What is the InChIKey of 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole?
The InChIKey is FXEPWHXEXVMLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-2-8-3-4-11-9(5-8)6-10-7-13-14-12(10)11/h2-5,7H,1,6H2,(H,13,14).
What are the key properties of 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole?
6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole has a molecular weight of 182.23 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-1,4-dihydroindeno[2,1-d]pyrazole is sourced from PubChem (CID 142940477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).