About ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde
ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde (PubChem CID 142940478) has the molecular formula C14H16N2O
and a molecular weight of 228.29 g/mol. Its IUPAC name is ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde.
Molecular Properties
| Compound Name | ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde |
| PubChem CID | 142940478 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde |
| SMILES | CC.Cc1[nH]nc2c1Cc1cc(C=O)ccc1-2 |
| InChI | InChI=1S/C12H10N2O.C2H6/c1-7-11-5-9-4-8(6-15)2-3-10(9)12(11)14-13-7;1-2/h2-4,6H,5H2,1H3,(H,13,14);1-2H3 |
| InChIKey | WDBIJTFQYXNFBB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde?
The IUPAC name of ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde (CID 142940478) is ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde.
What is the SMILES notation for ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde?
The canonical SMILES for ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde is CC.Cc1[nH]nc2c1Cc1cc(C=O)ccc1-2.
What is the InChIKey of ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde?
The InChIKey is WDBIJTFQYXNFBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O.C2H6/c1-7-11-5-9-4-8(6-15)2-3-10(9)12(11)14-13-7;1-2/h2-4,6H,5H2,1H3,(H,13,14);1-2H3.
What are the key properties of ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde?
ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde has a molecular weight of 228.29 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2,4-dihydroindeno[1,2-c]pyrazole-6-carbaldehyde is sourced from PubChem (CID 142940478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).