About 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene
1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 142940805) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene.
Molecular Properties
| Compound Name | 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene |
| PubChem CID | 142940805 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | CCc1ccc(C2=CC=C(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H22/c1-4-14-5-7-16(8-6-14)17-11-9-15(10-12-17)13(2)3/h5-9,11,13H,4,10,12H2,1-3H3 |
| InChIKey | BUOSHJXFSDSOBI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene?
The IUPAC name of 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene (CID 142940805) is 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene.
What is the SMILES notation for 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene?
The canonical SMILES for 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene is CCc1ccc(C2=CC=C(C(C)C)CC2)cc1.
What is the InChIKey of 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene?
The InChIKey is BUOSHJXFSDSOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22/c1-4-14-5-7-16(8-6-14)17-11-9-15(10-12-17)13(2)3/h5-9,11,13H,4,10,12H2,1-3H3.
What are the key properties of 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene?
1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene has a molecular weight of 226.36 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(4-propan-2-ylcyclohexa-1,3-dien-1-yl)benzene is sourced from PubChem (CID 142940805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).