About ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene
ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene (PubChem CID 142940851) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene |
| PubChem CID | 142940851 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene |
| SMILES | CC.CCC1=CC=C(c2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C16H20.C2H6/c1-4-13-5-6-16(11-13)15-9-7-14(8-10-15)12(2)3;1-2/h5-10,12H,4,11H2,1-3H3;1-2H3 |
| InChIKey | ILILBPUCTGWLKO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene?
The IUPAC name of ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene (CID 142940851) is ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene.
What is the SMILES notation for ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene?
The canonical SMILES for ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene is CC.CCC1=CC=C(c2ccc(C(C)C)cc2)C1.
What is the InChIKey of ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene?
The InChIKey is ILILBPUCTGWLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20.C2H6/c1-4-13-5-6-16(11-13)15-9-7-14(8-10-15)12(2)3;1-2/h5-10,12H,4,11H2,1-3H3;1-2H3.
What are the key properties of ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene?
ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene has a molecular weight of 242.41 g/mol, XLogP of 5.96, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-ethylcyclopenta-1,3-dien-1-yl)-4-propan-2-ylbenzene is sourced from PubChem (CID 142940851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).