C37H45F2N3O2 — CID 142941085
6-(1,3-benzodioxol-5-yl)-N-[(2,4-difluorophenyl)methyl]-4-[1-[methyl(pentan-3-yl)amino]ethenyl]quinolin-2-amine;hexane (PubChem CID 142941085) has the molecular formula C37H45F2N3O2 and a molecular weight of 601.78 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-N-[(2,4-difluorophenyl)methyl]-4-[1-[methyl(pentan-3-yl)amino]ethenyl]quinolin-2-amine;hexane.
| Compound Name | 6-(1,3-benzodioxol-5-yl)-N-[(2,4-difluorophenyl)methyl]-4-[1-[methyl(pentan-3-yl)amino]ethenyl]quinolin-2-amine;hexane |
|---|---|
| PubChem CID | 142941085 |
| Molecular Formula | C37H45F2N3O2 |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-N-[(2,4-difluorophenyl)methyl]-4-[1-[methyl(pentan-3-yl)amino]ethenyl]quinolin-2-amine;hexane |
| SMILES | C=C(c1cc(NCc2ccc(F)cc2F)nc2ccc(-c3ccc4c(c3)OCO4)cc12)N(C)C(CC)CC.CCCCCC |
| InChI | InChI=1S/C31H31F2N3O2.C6H14/c1-5-24(6-2)36(4)19(3)25-16-31(34-17-22-7-10-23(32)15-27(22)33)35-28-11-8-20(13-26(25)28)21-9-12-29-30(14-21)38-18-37-29;1-3-5-6-4-2/h7-16,24H,3,5-6,17-18H2,1-2,4H3,(H,34,35);3-6H2,1-2H3 |
| InChIKey | LBIKCWYBACBHLH-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|