C11H20N2OS — CID 142941248
2-[(cyclopentylamino)methyl]pyrrolidine-1-carbothioic S-acid (PubChem CID 142941248) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-[(cyclopentylamino)methyl]pyrrolidine-1-carbothioic S-acid.
| Compound Name | 2-[(cyclopentylamino)methyl]pyrrolidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 142941248 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[(cyclopentylamino)methyl]pyrrolidine-1-carbothioic S-acid |
| SMILES | O=C(S)N1CCCC1CNC1CCCC1 |
| InChI | InChI=1S/C11H20N2OS/c14-11(15)13-7-3-6-10(13)8-12-9-4-1-2-5-9/h9-10,12H,1-8H2,(H,14,15) |
| InChIKey | PNJOYWULOYYKOB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|