C10H17N5 — CID 142941462
2-(6-ethyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)guanidine (PubChem CID 142941462) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-(6-ethyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)guanidine.
| Compound Name | 2-(6-ethyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)guanidine |
|---|---|
| PubChem CID | 142941462 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 2-(6-ethyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)guanidine |
| SMILES | CCC1CCc2nc(N=C(N)N)[nH]c2C1 |
| InChI | InChI=1S/C10H17N5/c1-2-6-3-4-7-8(5-6)14-10(13-7)15-9(11)12/h6H,2-5H2,1H3,(H5,11,12,13,14,15) |
| InChIKey | BRBGSANDBXVSGN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|